C11H17N3O3 — CID 110703425
N-cyclopentyl-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide (PubChem CID 110703425) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is N-cyclopentyl-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide.
| Compound Name | N-cyclopentyl-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide |
|---|---|
| PubChem CID | 110703425 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | N-cyclopentyl-2-(1-methyl-3,5-dioxopyrazolidin-4-yl)acetamide |
| SMILES | CN1NC(=O)C(CC(=O)NC2CCCC2)C1=O |
| InChI | InChI=1S/C11H17N3O3/c1-14-11(17)8(10(16)13-14)6-9(15)12-7-4-2-3-5-7/h7-8H,2-6H2,1H3,(H,12,15)(H,13,16) |
| InChIKey | CQVISYJVJFZGIY-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|