C11H18N4O3 — CID 110703437
1-methyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyrazolidine-3,5-dione (PubChem CID 110703437) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-methyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyrazolidine-3,5-dione.
| Compound Name | 1-methyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 110703437 |
| Molecular Formula | C11H18N4O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 1-methyl-4-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]pyrazolidine-3,5-dione |
| SMILES | CN1CCN(C(=O)CC2C(=O)NN(C)C2=O)CC1 |
| InChI | InChI=1S/C11H18N4O3/c1-13-3-5-15(6-4-13)9(16)7-8-10(17)12-14(2)11(8)18/h8H,3-7H2,1-2H3,(H,12,17) |
| InChIKey | CJWBGMNMENMOKQ-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|