C17H14Cl2N2O7S — CID 1107107
(4-nitrophenyl) 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 1107107) has the molecular formula C17H14Cl2N2O7S and a molecular weight of 461.28 g/mol. Its IUPAC name is (4-nitrophenyl) 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (4-nitrophenyl) 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 1107107 |
| Molecular Formula | C17H14Cl2N2O7S |
| Molecular Weight | 461.28 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | (4-nitrophenyl) 2,4-dichloro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)c1cc(S(=O)(=O)N2CCOCC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl2N2O7S/c18-14-10-15(19)16(29(25,26)20-5-7-27-8-6-20)9-13(14)17(22)28-12-3-1-11(2-4-12)21(23)24/h1-4,9-10H,5-8H2 |
| InChIKey | YZSLHTGHOYPHJC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|