C15H14FNO2S — CID 110711280
2-(2-fluorophenoxy)-N-(2-thiophen-2-ylcyclopropyl)acetamide (PubChem CID 110711280) has the molecular formula C15H14FNO2S and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-(2-thiophen-2-ylcyclopropyl)acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-(2-thiophen-2-ylcyclopropyl)acetamide |
|---|---|
| PubChem CID | 110711280 |
| Molecular Formula | C15H14FNO2S |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-(2-thiophen-2-ylcyclopropyl)acetamide |
| SMILES | O=C(COc1ccccc1F)NC1CC1c1cccs1 |
| InChI | InChI=1S/C15H14FNO2S/c16-11-4-1-2-5-13(11)19-9-15(18)17-12-8-10(12)14-6-3-7-20-14/h1-7,10,12H,8-9H2,(H,17,18) |
| InChIKey | TVMOTUITPFRRTL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |