C17H18FNO2S — CID 119099271
2-(2-fluorophenoxy)-N-(1-thiophen-2-ylcyclopentyl)acetamide (PubChem CID 119099271) has the molecular formula C17H18FNO2S and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)-N-(1-thiophen-2-ylcyclopentyl)acetamide.
| Compound Name | 2-(2-fluorophenoxy)-N-(1-thiophen-2-ylcyclopentyl)acetamide |
|---|---|
| PubChem CID | 119099271 |
| Molecular Formula | C17H18FNO2S |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-(2-fluorophenoxy)-N-(1-thiophen-2-ylcyclopentyl)acetamide |
| SMILES | O=C(COc1ccccc1F)NC1(c2cccs2)CCCC1 |
| InChI | InChI=1S/C17H18FNO2S/c18-13-6-1-2-7-14(13)21-12-16(20)19-17(9-3-4-10-17)15-8-5-11-22-15/h1-2,5-8,11H,3-4,9-10,12H2,(H,19,20) |
| InChIKey | GLOBRIDJEFUWJD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |