C20H20FNO2S — CID 90574572
N-[4-(2-fluorophenoxy)but-2-ynyl]-1-thiophen-2-ylcyclopentane-1-carboxamide (PubChem CID 90574572) has the molecular formula C20H20FNO2S and a molecular weight of 357.45 g/mol. Its IUPAC name is N-[4-(2-fluorophenoxy)but-2-ynyl]-1-thiophen-2-ylcyclopentane-1-carboxamide.
| Compound Name | N-[4-(2-fluorophenoxy)but-2-ynyl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 90574572 |
| Molecular Formula | C20H20FNO2S |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[4-(2-fluorophenoxy)but-2-ynyl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
| SMILES | O=C(NCC#CCOc1ccccc1F)C1(c2cccs2)CCCC1 |
| InChI | InChI=1S/C20H20FNO2S/c21-16-8-1-2-9-17(16)24-14-6-5-13-22-19(23)20(11-3-4-12-20)18-10-7-15-25-18/h1-2,7-10,15H,3-4,11-14H2,(H,22,23) |
| InChIKey | IXOXVHDYQGEDRH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|