C16H19N3O2S2 — CID 110711996
5-ethyl-N-[2-(1-methylbenzimidazol-2-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 110711996) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 5-ethyl-N-[2-(1-methylbenzimidazol-2-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[2-(1-methylbenzimidazol-2-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110711996 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 5-ethyl-N-[2-(1-methylbenzimidazol-2-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCCc2nc3ccccc3n2C)s1 |
| InChI | InChI=1S/C16H19N3O2S2/c1-3-12-8-9-16(22-12)23(20,21)17-11-10-15-18-13-6-4-5-7-14(13)19(15)2/h4-9,17H,3,10-11H2,1-2H3 |
| InChIKey | IZIIOCIRRJLXQN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |