C16H18N2O2S — CID 110715148
1-benzylsulfonyl-4-methyl-2,3-dihydroquinoxaline (PubChem CID 110715148) has the molecular formula C16H18N2O2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-benzylsulfonyl-4-methyl-2,3-dihydroquinoxaline.
| Compound Name | 1-benzylsulfonyl-4-methyl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 110715148 |
| Molecular Formula | C16H18N2O2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-benzylsulfonyl-4-methyl-2,3-dihydroquinoxaline |
| SMILES | CN1CCN(S(=O)(=O)Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C16H18N2O2S/c1-17-11-12-18(16-10-6-5-9-15(16)17)21(19,20)13-14-7-3-2-4-8-14/h2-10H,11-13H2,1H3 |
| InChIKey | QLNHZZPRAUMPMA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |