About 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one
5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one (PubChem CID 63776643) has the molecular formula C14H15N3O3S
and a molecular weight of 305.36 g/mol. Its IUPAC name is 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one |
| PubChem CID | 63776643 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(=O)[nH]c2)c2ccccc21 |
| InChI | InChI=1S/C14H15N3O3S/c1-16-8-9-17(13-5-3-2-4-12(13)16)21(19,20)11-6-7-14(18)15-10-11/h2-7,10H,8-9H2,1H3,(H,15,18) |
| InChIKey | KYULFDMFGCRBFJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one?
The IUPAC name of 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one (CID 63776643) is 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one.
What is the SMILES notation for 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one?
The canonical SMILES for 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one is CN1CCN(S(=O)(=O)c2ccc(=O)[nH]c2)c2ccccc21.
What is the InChIKey of 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one?
The InChIKey is KYULFDMFGCRBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O3S/c1-16-8-9-17(13-5-3-2-4-12(13)16)21(19,20)11-6-7-14(18)15-10-11/h2-7,10H,8-9H2,1H3,(H,15,18).
What are the key properties of 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one?
5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one has a molecular weight of 305.36 g/mol, XLogP of 1.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-methyl-2,3-dihydroquinoxalin-1-yl)sulfonyl]-1H-pyridin-2-one is sourced from PubChem (CID 63776643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).