About 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline
1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline (PubChem CID 63778567) has the molecular formula C14H22N4O2S
and a molecular weight of 310.42 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline.
Molecular Properties
| Compound Name | 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline |
| PubChem CID | 63778567 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline |
| SMILES | CN1CCN(S(=O)(=O)N2CCCNCC2)c2ccccc21 |
| InChI | InChI=1S/C14H22N4O2S/c1-16-11-12-18(14-6-3-2-5-13(14)16)21(19,20)17-9-4-7-15-8-10-17/h2-3,5-6,15H,4,7-12H2,1H3 |
| InChIKey | UMZKDOCLRFFAPC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline?
The IUPAC name of 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline (CID 63778567) is 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline.
What is the SMILES notation for 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline?
The canonical SMILES for 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline is CN1CCN(S(=O)(=O)N2CCCNCC2)c2ccccc21.
What is the InChIKey of 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline?
The InChIKey is UMZKDOCLRFFAPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N4O2S/c1-16-11-12-18(14-6-3-2-5-13(14)16)21(19,20)17-9-4-7-15-8-10-17/h2-3,5-6,15H,4,7-12H2,1H3.
What are the key properties of 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline?
1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline has a molecular weight of 310.42 g/mol, XLogP of 0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline is sourced from PubChem (CID 63778567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).