C14H22N4O2S — CID 63778567
1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline (PubChem CID 63778567) has the molecular formula C14H22N4O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline.
| Compound Name | 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 63778567 |
| Molecular Formula | C14H22N4O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-(1,4-diazepan-1-ylsulfonyl)-4-methyl-2,3-dihydroquinoxaline |
| SMILES | CN1CCN(S(=O)(=O)N2CCCNCC2)c2ccccc21 |
| InChI | InChI=1S/C14H22N4O2S/c1-16-11-12-18(14-6-3-2-5-13(14)16)21(19,20)17-9-4-7-15-8-10-17/h2-3,5-6,15H,4,7-12H2,1H3 |
| InChIKey | UMZKDOCLRFFAPC-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |