C13H17N3O4S2 — CID 110717920
N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-2,4-dimethoxybenzenesulfonamide (PubChem CID 110717920) has the molecular formula C13H17N3O4S2 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-2,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-2,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110717920 |
| Molecular Formula | C13H17N3O4S2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[2-(2-amino-1,3-thiazol-4-yl)ethyl]-2,4-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCc2csc(N)n2)c(OC)c1 |
| InChI | InChI=1S/C13H17N3O4S2/c1-19-10-3-4-12(11(7-10)20-2)22(17,18)15-6-5-9-8-21-13(14)16-9/h3-4,7-8,15H,5-6H2,1-2H3,(H2,14,16) |
| InChIKey | KVXWNVTYYZHGHB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |