C17H18N2O4S — CID 110720565
2,5-dimethyl-N-[4-(2-oxo-1,3-oxazolidin-5-yl)phenyl]benzenesulfonamide (PubChem CID 110720565) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 2,5-dimethyl-N-[4-(2-oxo-1,3-oxazolidin-5-yl)phenyl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[4-(2-oxo-1,3-oxazolidin-5-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110720565 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2,5-dimethyl-N-[4-(2-oxo-1,3-oxazolidin-5-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccc(C3CNC(=O)O3)cc2)c1 |
| InChI | InChI=1S/C17H18N2O4S/c1-11-3-4-12(2)16(9-11)24(21,22)19-14-7-5-13(6-8-14)15-10-18-17(20)23-15/h3-9,15,19H,10H2,1-2H3,(H,18,20) |
| InChIKey | UUTIWKSUEBRGFI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |