C13H16ClFN2O3S — CID 110720919
2-chloro-N-[2-(1,1-dioxothiazinan-2-yl)ethyl]-6-fluorobenzamide (PubChem CID 110720919) has the molecular formula C13H16ClFN2O3S and a molecular weight of 334.80 g/mol. Its IUPAC name is 2-chloro-N-[2-(1,1-dioxothiazinan-2-yl)ethyl]-6-fluorobenzamide.
| Compound Name | 2-chloro-N-[2-(1,1-dioxothiazinan-2-yl)ethyl]-6-fluorobenzamide |
|---|---|
| PubChem CID | 110720919 |
| Molecular Formula | C13H16ClFN2O3S |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 2-chloro-N-[2-(1,1-dioxothiazinan-2-yl)ethyl]-6-fluorobenzamide |
| SMILES | O=C(NCCN1CCCCS1(=O)=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C13H16ClFN2O3S/c14-10-4-3-5-11(15)12(10)13(18)16-6-8-17-7-1-2-9-21(17,19)20/h3-5H,1-2,6-9H2,(H,16,18) |
| InChIKey | HRLTZCPBQSPUSD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |