C12H14FIN2O3S — CID 60616296
N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-5-fluoro-2-iodobenzamide (PubChem CID 60616296) has the molecular formula C12H14FIN2O3S and a molecular weight of 412.22 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-5-fluoro-2-iodobenzamide.
| Compound Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-5-fluoro-2-iodobenzamide |
|---|---|
| PubChem CID | 60616296 |
| Molecular Formula | C12H14FIN2O3S |
| Molecular Weight | 412.22 g/mol |
| Exact Mass | 411.98 |
| IUPAC Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-5-fluoro-2-iodobenzamide |
| SMILES | O=C(NCCN1CCCS1(=O)=O)c1cc(F)ccc1I |
| InChI | InChI=1S/C12H14FIN2O3S/c13-9-2-3-11(14)10(8-9)12(17)15-4-6-16-5-1-7-20(16,18)19/h2-3,8H,1,4-7H2,(H,15,17) |
| InChIKey | SRVDPJUMCBSOSK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|