C41H44O9 — CID 11072473
[(1S,2R,4R,6R,7S,8S,12R,13S,15S)-13-benzoyloxy-15-hydroxy-4-(4-methoxyphenyl)-7,18,18-trimethyl-11-methylidene-14-oxo-3,5-dioxatetracyclo[13.2.1.02,6.07,12]octadecan-8-yl] benzoate (PubChem CID 11072473) has the molecular formula C41H44O9 and a molecular weight of 680.79 g/mol. Its IUPAC name is [(1S,2R,4R,6R,7S,8S,12R,13S,15S)-13-benzoyloxy-15-hydroxy-4-(4-methoxyphenyl)-7,18,18-trimethyl-11-methylidene-14-oxo-3,5-dioxatetracyclo[13.2.1.02,6.07,12]octadecan-8-yl] benzoate.
| Compound Name | [(1S,2R,4R,6R,7S,8S,12R,13S,15S)-13-benzoyloxy-15-hydroxy-4-(4-methoxyphenyl)-7,18,18-trimethyl-11-methylidene-14-oxo-3,5-dioxatetracyclo[13.2.1.02,6.07,12]octadecan-8-yl] benzoate |
|---|---|
| PubChem CID | 11072473 |
| Molecular Formula | C41H44O9 |
| Molecular Weight | 680.79 g/mol |
| Exact Mass | 680.30 |
| IUPAC Name | [(1S,2R,4R,6R,7S,8S,12R,13S,15S)-13-benzoyloxy-15-hydroxy-4-(4-methoxyphenyl)-7,18,18-trimethyl-11-methylidene-14-oxo-3,5-dioxatetracyclo[13.2.1.02,6.07,12]octadecan-8-yl] benzoate |
| SMILES | C=C1CC[C@H](OC(=O)c2ccccc2)[C@@]2(C)[C@H]3O[C@H](c4ccc(OC)cc4)O[C@@H]3[C@H]3CC[C@@](O)(C(=O)[C@@H](OC(=O)c4ccccc4)[C@H]12)C3(C)C |
| InChI | InChI=1S/C41H44O9/c1-24-16-21-30(47-36(43)25-12-8-6-9-13-25)40(4)31(24)33(48-37(44)26-14-10-7-11-15-26)34(42)41(45)23-22-29(39(41,2)3)32-35(40)50-38(49-32)27-17-19-28(46-5)20-18-27/h6-15,17-20,29-33,35,38,45H,1,16,21-23H2,2-5H3/t29-,30+,31+,32-,33+,35+,38-,40-,41-/m1/s1 |
| InChIKey | JKAHYOKBOHUYDP-ZHNCKIHBSA-N |
| XLogP | 6.65 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.79 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|