C27H36O7 — CID 10896023
(1S,2R,4R,6R,7S,8S,12R,13S,15S)-8,13,15-trihydroxy-4-(4-methoxyphenyl)-7,18,18-trimethyl-11-methylidene-3,5-dioxatetracyclo[13.2.1.02,6.07,12]octadecan-14-one (PubChem CID 10896023) has the molecular formula C27H36O7 and a molecular weight of 472.58 g/mol. Its IUPAC name is (1S,2R,4R,6R,7S,8S,12R,13S,15S)-8,13,15-trihydroxy-4-(4-methoxyphenyl)-7,18,18-trimethyl-11-methylidene-3,5-dioxatetracyclo[13.2.1.02,6.07,12]octadecan-14-one.
| Compound Name | (1S,2R,4R,6R,7S,8S,12R,13S,15S)-8,13,15-trihydroxy-4-(4-methoxyphenyl)-7,18,18-trimethyl-11-methylidene-3,5-dioxatetracyclo[13.2.1.02,6.07,12]octadecan-14-one |
|---|---|
| PubChem CID | 10896023 |
| Molecular Formula | C27H36O7 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | (1S,2R,4R,6R,7S,8S,12R,13S,15S)-8,13,15-trihydroxy-4-(4-methoxyphenyl)-7,18,18-trimethyl-11-methylidene-3,5-dioxatetracyclo[13.2.1.02,6.07,12]octadecan-14-one |
| SMILES | C=C1CC[C@H](O)[C@@]2(C)[C@H]3O[C@H](c4ccc(OC)cc4)O[C@@H]3[C@H]3CC[C@@](O)(C(=O)[C@@H](O)[C@H]12)C3(C)C |
| InChI | InChI=1S/C27H36O7/c1-14-6-11-18(28)26(4)19(14)20(29)22(30)27(31)13-12-17(25(27,2)3)21-23(26)34-24(33-21)15-7-9-16(32-5)10-8-15/h7-10,17-21,23-24,28-29,31H,1,6,11-13H2,2-5H3/t17-,18+,19+,20+,21-,23+,24-,26-,27-/m1/s1 |
| InChIKey | ZRBHFLIGOVPNFT-XFXIKLKLSA-N |
| XLogP | 2.92 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|