C13H10ClN3O2S2 — CID 110726466
5-chloro-N-[3-(1H-imidazol-2-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 110726466) has the molecular formula C13H10ClN3O2S2 and a molecular weight of 339.83 g/mol. Its IUPAC name is 5-chloro-N-[3-(1H-imidazol-2-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-(1H-imidazol-2-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110726466 |
| Molecular Formula | C13H10ClN3O2S2 |
| Molecular Weight | 339.83 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 5-chloro-N-[3-(1H-imidazol-2-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2ncc[nH]2)c1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C13H10ClN3O2S2/c14-11-4-5-12(20-11)21(18,19)17-10-3-1-2-9(8-10)13-15-6-7-16-13/h1-8,17H,(H,15,16) |
| InChIKey | WNFMXFVLAFTJAY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |