C15H13F3N2O2 — CID 110730365
N-[(1-methyl-2-oxo-3-pyridinyl)methyl]-4-(trifluoromethyl)benzamide (PubChem CID 110730365) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is N-[(1-methyl-2-oxo-3-pyridinyl)methyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[(1-methyl-2-oxo-3-pyridinyl)methyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 110730365 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | N-[(1-methyl-2-oxo-3-pyridinyl)methyl]-4-(trifluoromethyl)benzamide |
| SMILES | Cn1cccc(CNC(=O)c2ccc(C(F)(F)F)cc2)c1=O |
| InChI | InChI=1S/C15H13F3N2O2/c1-20-8-2-3-11(14(20)22)9-19-13(21)10-4-6-12(7-5-10)15(16,17)18/h2-8H,9H2,1H3,(H,19,21) |
| InChIKey | ZTVGLKSUPLURJA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |