C15H18N2O3S2 — CID 110749043
1-methyl-3-(4-methylphenyl)sulfonyl-1-(2-thiophen-2-ylethyl)urea (PubChem CID 110749043) has the molecular formula C15H18N2O3S2 and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-methyl-3-(4-methylphenyl)sulfonyl-1-(2-thiophen-2-ylethyl)urea.
| Compound Name | 1-methyl-3-(4-methylphenyl)sulfonyl-1-(2-thiophen-2-ylethyl)urea |
|---|---|
| PubChem CID | 110749043 |
| Molecular Formula | C15H18N2O3S2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 1-methyl-3-(4-methylphenyl)sulfonyl-1-(2-thiophen-2-ylethyl)urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N(C)CCc2cccs2)cc1 |
| InChI | InChI=1S/C15H18N2O3S2/c1-12-5-7-14(8-6-12)22(19,20)16-15(18)17(2)10-9-13-4-3-11-21-13/h3-8,11H,9-10H2,1-2H3,(H,16,18) |
| InChIKey | VZNFKCOIHFBCKP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |