C18H23N3O4S2 — CID 9474767
N,4-dimethyl-N-[2-oxo-2-[2-(4-thiophen-2-ylbutanoyl)hydrazinyl]ethyl]benzenesulfonamide (PubChem CID 9474767) has the molecular formula C18H23N3O4S2 and a molecular weight of 409.53 g/mol. Its IUPAC name is N,4-dimethyl-N-[2-oxo-2-[2-(4-thiophen-2-ylbutanoyl)hydrazinyl]ethyl]benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-[2-oxo-2-[2-(4-thiophen-2-ylbutanoyl)hydrazinyl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 9474767 |
| Molecular Formula | C18H23N3O4S2 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | N,4-dimethyl-N-[2-oxo-2-[2-(4-thiophen-2-ylbutanoyl)hydrazinyl]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)NNC(=O)CCCc2cccs2)cc1 |
| InChI | InChI=1S/C18H23N3O4S2/c1-14-8-10-16(11-9-14)27(24,25)21(2)13-18(23)20-19-17(22)7-3-5-15-6-4-12-26-15/h4,6,8-12H,3,5,7,13H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | IVLZTFXPOLXQPH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|