C19H26N2O3S2 — CID 110415330
N-[2-[methyl-(4-methylphenyl)sulfonylamino]ethyl]-5-thiophen-2-ylpentanamide (PubChem CID 110415330) has the molecular formula C19H26N2O3S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is N-[2-[methyl-(4-methylphenyl)sulfonylamino]ethyl]-5-thiophen-2-ylpentanamide.
| Compound Name | N-[2-[methyl-(4-methylphenyl)sulfonylamino]ethyl]-5-thiophen-2-ylpentanamide |
|---|---|
| PubChem CID | 110415330 |
| Molecular Formula | C19H26N2O3S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-[2-[methyl-(4-methylphenyl)sulfonylamino]ethyl]-5-thiophen-2-ylpentanamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CCNC(=O)CCCCc2cccs2)cc1 |
| InChI | InChI=1S/C19H26N2O3S2/c1-16-9-11-18(12-10-16)26(23,24)21(2)14-13-20-19(22)8-4-3-6-17-7-5-15-25-17/h5,7,9-12,15H,3-4,6,8,13-14H2,1-2H3,(H,20,22) |
| InChIKey | DUZZOJISWVUUOU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|