C19H23N3O4S — CID 110609610
N-[2-[methyl-(4-methylphenyl)sulfonylamino]ethyl]-4-oxo-4-pyridin-3-ylbutanamide (PubChem CID 110609610) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[2-[methyl-(4-methylphenyl)sulfonylamino]ethyl]-4-oxo-4-pyridin-3-ylbutanamide.
| Compound Name | N-[2-[methyl-(4-methylphenyl)sulfonylamino]ethyl]-4-oxo-4-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 110609610 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[2-[methyl-(4-methylphenyl)sulfonylamino]ethyl]-4-oxo-4-pyridin-3-ylbutanamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CCNC(=O)CCC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C19H23N3O4S/c1-15-5-7-17(8-6-15)27(25,26)22(2)13-12-21-19(24)10-9-18(23)16-4-3-11-20-14-16/h3-8,11,14H,9-10,12-13H2,1-2H3,(H,21,24) |
| InChIKey | HOFUCXWSABPSAO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |