C12H13ClN2O3S2 — CID 110757998
5-chloro-4-ethoxy-2-methyl-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 110757998) has the molecular formula C12H13ClN2O3S2 and a molecular weight of 332.83 g/mol. Its IUPAC name is 5-chloro-4-ethoxy-2-methyl-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-4-ethoxy-2-methyl-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110757998 |
| Molecular Formula | C12H13ClN2O3S2 |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | 5-chloro-4-ethoxy-2-methyl-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CCOc1cc(C)c(S(=O)(=O)Nc2nccs2)cc1Cl |
| InChI | InChI=1S/C12H13ClN2O3S2/c1-3-18-10-6-8(2)11(7-9(10)13)20(16,17)15-12-14-4-5-19-12/h4-7H,3H2,1-2H3,(H,14,15) |
| InChIKey | PGDHLHHPYZCLAW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |