C21H34 — CID 11077013
(7Z)-7-butylheptadeca-7,9,10-trien-5-yne (PubChem CID 11077013) has the molecular formula C21H34 and a molecular weight of 286.50 g/mol. Its IUPAC name is (7Z)-7-butylheptadeca-7,9,10-trien-5-yne.
| Compound Name | (7Z)-7-butylheptadeca-7,9,10-trien-5-yne |
|---|---|
| PubChem CID | 11077013 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | (7Z)-7-butylheptadeca-7,9,10-trien-5-yne |
| SMILES | CCCCC#C/C(=C\C=C=CCCCCCC)CCCC |
| InChI | InChI=1S/C21H34/c1-4-7-10-12-13-14-15-17-20-21(18-9-6-3)19-16-11-8-5-2/h14,17,20H,4-13,18H2,1-3H3/b21-20- |
| InChIKey | RJCHMPNHUYEVHV-MRCUWXFGSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|