About methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate
methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate (PubChem CID 11077158) has the molecular formula C16H21NO4
and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate.
Molecular Properties
| Compound Name | methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate |
| PubChem CID | 11077158 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate |
| SMILES | CC[C@@]1(CCC(=O)OC)N[C@@H](c2ccccc2)COC1=O |
| InChI | InChI=1S/C16H21NO4/c1-3-16(10-9-14(18)20-2)15(19)21-11-13(17-16)12-7-5-4-6-8-12/h4-8,13,17H,3,9-11H2,1-2H3/t13-,16+/m1/s1 |
| InChIKey | HGEXECOXLYCEEA-CJNGLKHVSA-N |
| XLogP | 1.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate?
The IUPAC name of methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate (CID 11077158) is methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate.
What is the SMILES notation for methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate?
The canonical SMILES for methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate is CC[C@@]1(CCC(=O)OC)N[C@@H](c2ccccc2)COC1=O.
What is the InChIKey of methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate?
The InChIKey is HGEXECOXLYCEEA-CJNGLKHVSA-N. The full InChI is InChI=1S/C16H21NO4/c1-3-16(10-9-14(18)20-2)15(19)21-11-13(17-16)12-7-5-4-6-8-12/h4-8,13,17H,3,9-11H2,1-2H3/t13-,16+/m1/s1.
What are the key properties of methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate?
methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate has a molecular weight of 291.35 g/mol, XLogP of 1.98, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3S,5S)-3-ethyl-2-oxo-5-phenylmorpholin-3-yl]propanoate is sourced from PubChem (CID 11077158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).