C16H19N3O3S — CID 110771595
4-[2-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)acetyl]piperazine-1-carbaldehyde (PubChem CID 110771595) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 4-[2-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)acetyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)acetyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 110771595 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 4-[2-(2-methyl-3-oxo-4H-1,4-benzothiazin-6-yl)acetyl]piperazine-1-carbaldehyde |
| SMILES | CC1Sc2ccc(CC(=O)N3CCN(C=O)CC3)cc2NC1=O |
| InChI | InChI=1S/C16H19N3O3S/c1-11-16(22)17-13-8-12(2-3-14(13)23-11)9-15(21)19-6-4-18(10-20)5-7-19/h2-3,8,10-11H,4-7,9H2,1H3,(H,17,22) |
| InChIKey | RWOCGGNXWBMNBS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|