C16H13NO5 — CID 11077411
(4bR,9bR)-4b,7,9b-trihydroxy-8-methoxy-5H-indeno[1,2-b]indol-10-one (PubChem CID 11077411) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is (4bR,9bR)-4b,7,9b-trihydroxy-8-methoxy-5H-indeno[1,2-b]indol-10-one.
| Compound Name | (4bR,9bR)-4b,7,9b-trihydroxy-8-methoxy-5H-indeno[1,2-b]indol-10-one |
|---|---|
| PubChem CID | 11077411 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | (4bR,9bR)-4b,7,9b-trihydroxy-8-methoxy-5H-indeno[1,2-b]indol-10-one |
| SMILES | COc1cc2c(cc1O)N[C@@]1(O)c3ccccc3C(=O)[C@@]21O |
| InChI | InChI=1S/C16H13NO5/c1-22-13-6-10-11(7-12(13)18)17-16(21)9-5-3-2-4-8(9)14(19)15(10,16)20/h2-7,17-18,20-21H,1H3/t15-,16+/m0/s1 |
| InChIKey | XPJDUJFSOOBKOH-JKSUJKDBSA-N |
| XLogP | 1.06 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|