C32H32O6 — CID 10625573
9,10-bis(2,5-dimethoxy-4-methylphenyl)phenanthrene-9,10-diol (PubChem CID 10625573) has the molecular formula C32H32O6 and a molecular weight of 512.60 g/mol. Its IUPAC name is 9,10-bis(2,5-dimethoxy-4-methylphenyl)phenanthrene-9,10-diol.
| Compound Name | 9,10-bis(2,5-dimethoxy-4-methylphenyl)phenanthrene-9,10-diol |
|---|---|
| PubChem CID | 10625573 |
| Molecular Formula | C32H32O6 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 9,10-bis(2,5-dimethoxy-4-methylphenyl)phenanthrene-9,10-diol |
| SMILES | COc1cc(C2(O)c3ccccc3-c3ccccc3C2(O)c2cc(OC)c(C)cc2OC)c(OC)cc1C |
| InChI | InChI=1S/C32H32O6/c1-19-15-29(37-5)25(17-27(19)35-3)31(33)23-13-9-7-11-21(23)22-12-8-10-14-24(22)32(31,34)26-18-28(36-4)20(2)16-30(26)38-6/h7-18,33-34H,1-6H3 |
| InChIKey | BPLXVYUXKKDPRL-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |