C14H19N3O2S — CID 110774699
1-(2,2-dimethylpropyl)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)urea (PubChem CID 110774699) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)urea.
| Compound Name | 1-(2,2-dimethylpropyl)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)urea |
|---|---|
| PubChem CID | 110774699 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-(3-oxo-4H-1,4-benzothiazin-6-yl)urea |
| SMILES | CC(C)(C)CNC(=O)Nc1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C14H19N3O2S/c1-14(2,3)8-15-13(19)16-9-4-5-11-10(6-9)17-12(18)7-20-11/h4-6H,7-8H2,1-3H3,(H,17,18)(H2,15,16,19) |
| InChIKey | SZUUFCLAJZEJQG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |