C17H16F2OS2 — CID 11078271
(4-fluorophenyl)-[2-(4-fluorophenyl)-1,3-dithian-2-yl]methanol (PubChem CID 11078271) has the molecular formula C17H16F2OS2 and a molecular weight of 338.44 g/mol. Its IUPAC name is (4-fluorophenyl)-[2-(4-fluorophenyl)-1,3-dithian-2-yl]methanol.
| Compound Name | (4-fluorophenyl)-[2-(4-fluorophenyl)-1,3-dithian-2-yl]methanol |
|---|---|
| PubChem CID | 11078271 |
| Molecular Formula | C17H16F2OS2 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (4-fluorophenyl)-[2-(4-fluorophenyl)-1,3-dithian-2-yl]methanol |
| SMILES | OC(c1ccc(F)cc1)C1(c2ccc(F)cc2)SCCCS1 |
| InChI | InChI=1S/C17H16F2OS2/c18-14-6-2-12(3-7-14)16(20)17(21-10-1-11-22-17)13-4-8-15(19)9-5-13/h2-9,16,20H,1,10-11H2 |
| InChIKey | ANZQRAJZSCKEMP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |