C13H28O6P2 — CID 11078383
1,1-bis(diethoxyphosphoryl)pent-1-ene (PubChem CID 11078383) has the molecular formula C13H28O6P2 and a molecular weight of 342.31 g/mol. Its IUPAC name is 1,1-bis(diethoxyphosphoryl)pent-1-ene.
| Compound Name | 1,1-bis(diethoxyphosphoryl)pent-1-ene |
|---|---|
| PubChem CID | 11078383 |
| Molecular Formula | C13H28O6P2 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1,1-bis(diethoxyphosphoryl)pent-1-ene |
| SMILES | CCCC=C(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C13H28O6P2/c1-6-11-12-13(20(14,16-7-2)17-8-3)21(15,18-9-4)19-10-5/h12H,6-11H2,1-5H3 |
| InChIKey | IOVBXYGZISGLPZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|