C15H21NO10 — CID 11079295
[(4R,5S,6S,7R)-4,5,6-triacetyloxy-3-methoxy-4,5,6,7-tetrahydrooxazepin-7-yl]methyl acetate (PubChem CID 11079295) has the molecular formula C15H21NO10 and a molecular weight of 375.33 g/mol. Its IUPAC name is [(4R,5S,6S,7R)-4,5,6-triacetyloxy-3-methoxy-4,5,6,7-tetrahydrooxazepin-7-yl]methyl acetate.
| Compound Name | [(4R,5S,6S,7R)-4,5,6-triacetyloxy-3-methoxy-4,5,6,7-tetrahydrooxazepin-7-yl]methyl acetate |
|---|---|
| PubChem CID | 11079295 |
| Molecular Formula | C15H21NO10 |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | [(4R,5S,6S,7R)-4,5,6-triacetyloxy-3-methoxy-4,5,6,7-tetrahydrooxazepin-7-yl]methyl acetate |
| SMILES | COC1=NO[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H21NO10/c1-7(17)22-6-11-12(23-8(2)18)13(24-9(3)19)14(25-10(4)20)15(21-5)16-26-11/h11-14H,6H2,1-5H3/t11-,12-,13+,14-/m1/s1 |
| InChIKey | UFUQAADEORVOGW-YIYPIFLZSA-N |
| XLogP | -0.30 |
| TPSA | 136.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|