C14H27ClN8O3 — CID 11079682
1-aminoethylidene-[(5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-(2H-tetrazol-5-ylamino)hexyl]azanium chloride (PubChem CID 11079682) has the molecular formula C14H27ClN8O3 and a molecular weight of 390.88 g/mol. Its IUPAC name is 1-aminoethylidene-[(5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-(2H-tetrazol-5-ylamino)hexyl]azanium chloride.
| Compound Name | 1-aminoethylidene-[(5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-(2H-tetrazol-5-ylamino)hexyl]azanium chloride |
|---|---|
| PubChem CID | 11079682 |
| Molecular Formula | C14H27ClN8O3 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-aminoethylidene-[(5S)-5-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxo-6-(2H-tetrazol-5-ylamino)hexyl]azanium chloride |
| SMILES | C/C(N)=[NH+]\CCCC[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1nn[nH]n1.[Cl-] |
| InChI | InChI=1S/C14H26N8O3.ClH/c1-9(15)16-8-6-5-7-10(17-13(24)25-14(2,3)4)11(23)18-12-19-21-22-20-12;/h10H,5-8H2,1-4H3,(H2,15,16)(H,17,24)(H2,18,19,20,21,22,23);1H/t10-;/m0./s1 |
| InChIKey | MOLAUVSTEJSFRX-PPHPATTJSA-N |
| XLogP | -4.34 |
| TPSA | 161.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | -4.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|