C15H27FN8O3 — CID 163629285
tert-butyl N-[(E,2S)-7-(1-aminoethylamino)-6-fluoro-1-oxo-1-(2H-tetrazol-5-ylamino)hept-5-en-2-yl]carbamate (PubChem CID 163629285) has the molecular formula C15H27FN8O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is tert-butyl N-[(E,2S)-7-(1-aminoethylamino)-6-fluoro-1-oxo-1-(2H-tetrazol-5-ylamino)hept-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E,2S)-7-(1-aminoethylamino)-6-fluoro-1-oxo-1-(2H-tetrazol-5-ylamino)hept-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 163629285 |
| Molecular Formula | C15H27FN8O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | tert-butyl N-[(E,2S)-7-(1-aminoethylamino)-6-fluoro-1-oxo-1-(2H-tetrazol-5-ylamino)hept-5-en-2-yl]carbamate |
| SMILES | CC(N)NC/C(F)=C\CC[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1nn[nH]n1 |
| InChI | InChI=1S/C15H27FN8O3/c1-9(17)18-8-10(16)6-5-7-11(19-14(26)27-15(2,3)4)12(25)20-13-21-23-24-22-13/h6,9,11,18H,5,7-8,17H2,1-4H3,(H,19,26)(H2,20,21,22,23,24,25)/b10-6+/t9?,11-/m0/s1 |
| InChIKey | HURNROUABGZVLA-XIUVXPLTSA-N |
| XLogP | 0.56 |
| TPSA | 159.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|