C9H20N8O — CID 4086220
2-amino-6-(1-aminoethylamino)-N-(2H-tetrazol-5-yl)hexanamide (PubChem CID 4086220) has the molecular formula C9H20N8O and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-amino-6-(1-aminoethylamino)-N-(2H-tetrazol-5-yl)hexanamide.
| Compound Name | 2-amino-6-(1-aminoethylamino)-N-(2H-tetrazol-5-yl)hexanamide |
|---|---|
| PubChem CID | 4086220 |
| Molecular Formula | C9H20N8O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | 2-amino-6-(1-aminoethylamino)-N-(2H-tetrazol-5-yl)hexanamide |
| SMILES | CC(N)NCCCCC(N)C(=O)Nc1nn[nH]n1 |
| InChI | InChI=1S/C9H20N8O/c1-6(10)12-5-3-2-4-7(11)8(18)13-9-14-16-17-15-9/h6-7,12H,2-5,10-11H2,1H3,(H2,13,14,15,16,17,18) |
| InChIKey | AGEDBFMDKGPUEN-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 147.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|