C24H26O5 — CID 11079759
1-[(2R,3R,4R,5S)-3-benzoyl-5-methyl-4-phenacyloxolan-2-yl]ethyl acetate (PubChem CID 11079759) has the molecular formula C24H26O5 and a molecular weight of 394.47 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5S)-3-benzoyl-5-methyl-4-phenacyloxolan-2-yl]ethyl acetate.
| Compound Name | 1-[(2R,3R,4R,5S)-3-benzoyl-5-methyl-4-phenacyloxolan-2-yl]ethyl acetate |
|---|---|
| PubChem CID | 11079759 |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 1-[(2R,3R,4R,5S)-3-benzoyl-5-methyl-4-phenacyloxolan-2-yl]ethyl acetate |
| SMILES | CC(=O)OC(C)[C@@H]1O[C@@H](C)[C@H](CC(=O)c2ccccc2)[C@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26O5/c1-15-20(14-21(26)18-10-6-4-7-11-18)22(23(27)19-12-8-5-9-13-19)24(29-15)16(2)28-17(3)25/h4-13,15-16,20,22,24H,14H2,1-3H3/t15-,16?,20-,22-,24-/m0/s1 |
| InChIKey | PRIGRJUQCJLWRN-UXVGNCPLSA-N |
| XLogP | 4.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |