C20H32O2S2Si — CID 11079819
2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dithian-2-yl]-1-phenylethanone (PubChem CID 11079819) has the molecular formula C20H32O2S2Si and a molecular weight of 396.69 g/mol. Its IUPAC name is 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dithian-2-yl]-1-phenylethanone.
| Compound Name | 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dithian-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 11079819 |
| Molecular Formula | C20H32O2S2Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 2-[2-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1,3-dithian-2-yl]-1-phenylethanone |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1(CC(=O)c2ccccc2)SCCCS1 |
| InChI | InChI=1S/C20H32O2S2Si/c1-19(2,3)25(4,5)22-13-12-20(23-14-9-15-24-20)16-18(21)17-10-7-6-8-11-17/h6-8,10-11H,9,12-16H2,1-5H3 |
| InChIKey | VYRVMTQZOKQREE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|