C20H38O5Si2 — CID 11080193
methyl (1S,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 11080193) has the molecular formula C20H38O5Si2 and a molecular weight of 414.69 g/mol. Its IUPAC name is methyl (1S,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | methyl (1S,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 11080193 |
| Molecular Formula | C20H38O5Si2 |
| Molecular Weight | 414.69 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | methyl (1S,4R,5R,6S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-7-oxabicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | COC(=O)C1=C[C@@H]2O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O5Si2/c1-19(2,3)26(8,9)24-15-13(18(21)22-7)12-14-16(23-14)17(15)25-27(10,11)20(4,5)6/h12,14-17H,1-11H3/t14-,15+,16-,17-/m0/s1 |
| InChIKey | FTYZPPCTOJQIDM-YVSFHVDLSA-N |
| XLogP | 4.65 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|