C28H42O2Si — CID 11080656
(2R,3aS,5aR,6R,8aS,8bS)-6-phenyl-2-[tri(propan-2-yl)silyloxymethyl]-2,3,3a,4,5a,6,8a,8b-octahydro-1H-acenaphthylen-5-one (PubChem CID 11080656) has the molecular formula C28H42O2Si and a molecular weight of 438.73 g/mol. Its IUPAC name is (2R,3aS,5aR,6R,8aS,8bS)-6-phenyl-2-[tri(propan-2-yl)silyloxymethyl]-2,3,3a,4,5a,6,8a,8b-octahydro-1H-acenaphthylen-5-one.
| Compound Name | (2R,3aS,5aR,6R,8aS,8bS)-6-phenyl-2-[tri(propan-2-yl)silyloxymethyl]-2,3,3a,4,5a,6,8a,8b-octahydro-1H-acenaphthylen-5-one |
|---|---|
| PubChem CID | 11080656 |
| Molecular Formula | C28H42O2Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | (2R,3aS,5aR,6R,8aS,8bS)-6-phenyl-2-[tri(propan-2-yl)silyloxymethyl]-2,3,3a,4,5a,6,8a,8b-octahydro-1H-acenaphthylen-5-one |
| SMILES | CC(C)[Si](OC[C@@H]1C[C@H]2C=C[C@@H](c3ccccc3)[C@@H]3C(=O)CC[C@H]1[C@@H]32)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H42O2Si/c1-18(2)31(19(3)4,20(5)6)30-17-23-16-22-12-13-24(21-10-8-7-9-11-21)28-26(29)15-14-25(23)27(22)28/h7-13,18-20,22-25,27-28H,14-17H2,1-6H3/t22-,23+,24+,25-,27+,28-/m1/s1 |
| InChIKey | LVNIREAHJXAELU-YTSCMWCKSA-N |
| XLogP | 7.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|