C28H43NO3SeSi — CID 11082172
ethyl N-benzyl-N-[(2S)-1-phenylselanyl-2-tri(propan-2-yl)silyloxypropyl]carbamate (PubChem CID 11082172) has the molecular formula C28H43NO3SeSi and a molecular weight of 548.70 g/mol. Its IUPAC name is ethyl N-benzyl-N-[(2S)-1-phenylselanyl-2-tri(propan-2-yl)silyloxypropyl]carbamate.
| Compound Name | ethyl N-benzyl-N-[(2S)-1-phenylselanyl-2-tri(propan-2-yl)silyloxypropyl]carbamate |
|---|---|
| PubChem CID | 11082172 |
| Molecular Formula | C28H43NO3SeSi |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | ethyl N-benzyl-N-[(2S)-1-phenylselanyl-2-tri(propan-2-yl)silyloxypropyl]carbamate |
| SMILES | CCOC(=O)N(Cc1ccccc1)C([Se]c1ccccc1)[C@H](C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C28H43NO3SeSi/c1-9-31-28(30)29(20-25-16-12-10-13-17-25)27(33-26-18-14-11-15-19-26)24(8)32-34(21(2)3,22(4)5)23(6)7/h10-19,21-24,27H,9,20H2,1-8H3/t24-,27?/m0/s1 |
| InChIKey | UZDSWHPYDCVGPQ-BXXZMZEQSA-N |
| XLogP | 6.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|