C15H13NO5S — CID 110823437
2-(4-methoxyphenyl)-2-(3-nitrophenyl)sulfanylacetic acid (PubChem CID 110823437) has the molecular formula C15H13NO5S and a molecular weight of 319.34 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-(3-nitrophenyl)sulfanylacetic acid.
| Compound Name | 2-(4-methoxyphenyl)-2-(3-nitrophenyl)sulfanylacetic acid |
|---|---|
| PubChem CID | 110823437 |
| Molecular Formula | C15H13NO5S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-(3-nitrophenyl)sulfanylacetic acid |
| SMILES | COc1ccc(C(Sc2cccc([N+](=O)[O-])c2)C(=O)O)cc1 |
| InChI | InChI=1S/C15H13NO5S/c1-21-12-7-5-10(6-8-12)14(15(17)18)22-13-4-2-3-11(9-13)16(19)20/h2-9,14H,1H3,(H,17,18) |
| InChIKey | IQPLFAYSKPTJOR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|