C17H12BrN3O4 — CID 110830250
2-[[3-(4-bromophenyl)-1,2-oxazol-5-yl]amino]-1-(3-nitrophenyl)ethanone (PubChem CID 110830250) has the molecular formula C17H12BrN3O4 and a molecular weight of 402.20 g/mol. Its IUPAC name is 2-[[3-(4-bromophenyl)-1,2-oxazol-5-yl]amino]-1-(3-nitrophenyl)ethanone.
| Compound Name | 2-[[3-(4-bromophenyl)-1,2-oxazol-5-yl]amino]-1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 110830250 |
| Molecular Formula | C17H12BrN3O4 |
| Molecular Weight | 402.20 g/mol |
| Exact Mass | 401.00 |
| IUPAC Name | 2-[[3-(4-bromophenyl)-1,2-oxazol-5-yl]amino]-1-(3-nitrophenyl)ethanone |
| SMILES | O=C(CNc1cc(-c2ccc(Br)cc2)no1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12BrN3O4/c18-13-6-4-11(5-7-13)15-9-17(25-20-15)19-10-16(22)12-2-1-3-14(8-12)21(23)24/h1-9,19H,10H2 |
| InChIKey | KRYULXUISQYNAS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.20 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|