C25H16BrClN2O5 — CID 4092157
[2-(3-nitrophenyl)-2-oxoethyl] 2-(4-bromophenyl)-7-chloro-8-methylquinoline-4-carboxylate (PubChem CID 4092157) has the molecular formula C25H16BrClN2O5 and a molecular weight of 539.77 g/mol. Its IUPAC name is [2-(3-nitrophenyl)-2-oxoethyl] 2-(4-bromophenyl)-7-chloro-8-methylquinoline-4-carboxylate.
| Compound Name | [2-(3-nitrophenyl)-2-oxoethyl] 2-(4-bromophenyl)-7-chloro-8-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 4092157 |
| Molecular Formula | C25H16BrClN2O5 |
| Molecular Weight | 539.77 g/mol |
| Exact Mass | 537.99 |
| IUPAC Name | [2-(3-nitrophenyl)-2-oxoethyl] 2-(4-bromophenyl)-7-chloro-8-methylquinoline-4-carboxylate |
| SMILES | Cc1c(Cl)ccc2c(C(=O)OCC(=O)c3cccc([N+](=O)[O-])c3)cc(-c3ccc(Br)cc3)nc12 |
| InChI | InChI=1S/C25H16BrClN2O5/c1-14-21(27)10-9-19-20(12-22(28-24(14)19)15-5-7-17(26)8-6-15)25(31)34-13-23(30)16-3-2-4-18(11-16)29(32)33/h2-12H,13H2,1H3 |
| InChIKey | HQISVISWCCAKTM-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 99.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.77 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|