C18H24N2O3S — CID 110830828
5-(azepan-1-ylmethyl)-4-(3,4-dimethoxyphenyl)-3H-1,3-thiazol-2-one (PubChem CID 110830828) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 5-(azepan-1-ylmethyl)-4-(3,4-dimethoxyphenyl)-3H-1,3-thiazol-2-one.
| Compound Name | 5-(azepan-1-ylmethyl)-4-(3,4-dimethoxyphenyl)-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 110830828 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 5-(azepan-1-ylmethyl)-4-(3,4-dimethoxyphenyl)-3H-1,3-thiazol-2-one |
| SMILES | COc1ccc(-c2[nH]c(=O)sc2CN2CCCCCC2)cc1OC |
| InChI | InChI=1S/C18H24N2O3S/c1-22-14-8-7-13(11-15(14)23-2)17-16(24-18(21)19-17)12-20-9-5-3-4-6-10-20/h7-8,11H,3-6,9-10,12H2,1-2H3,(H,19,21) |
| InChIKey | HSHVQYZMKMNDBI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |