C20H25N3O5 — CID 110832379
ethyl 4-[(E)-4-(4-acetylanilino)-2-methyl-4-oxobut-2-enoyl]piperazine-1-carboxylate (PubChem CID 110832379) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is ethyl 4-[(E)-4-(4-acetylanilino)-2-methyl-4-oxobut-2-enoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(E)-4-(4-acetylanilino)-2-methyl-4-oxobut-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 110832379 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | ethyl 4-[(E)-4-(4-acetylanilino)-2-methyl-4-oxobut-2-enoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)/C(C)=C/C(=O)Nc2ccc(C(C)=O)cc2)CC1 |
| InChI | InChI=1S/C20H25N3O5/c1-4-28-20(27)23-11-9-22(10-12-23)19(26)14(2)13-18(25)21-17-7-5-16(6-8-17)15(3)24/h5-8,13H,4,9-12H2,1-3H3,(H,21,25)/b14-13+ |
| InChIKey | UKXCAWKLPUPSBH-BUHFOSPRSA-N |
| XLogP | 2.07 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|