C9H8F3N3O3 — CID 110836259
2-[methyl-[2-(trifluoromethyl)pyrimidine-4-carbonyl]amino]acetic acid (PubChem CID 110836259) has the molecular formula C9H8F3N3O3 and a molecular weight of 263.17 g/mol. Its IUPAC name is 2-[methyl-[2-(trifluoromethyl)pyrimidine-4-carbonyl]amino]acetic acid.
| Compound Name | 2-[methyl-[2-(trifluoromethyl)pyrimidine-4-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 110836259 |
| Molecular Formula | C9H8F3N3O3 |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-[methyl-[2-(trifluoromethyl)pyrimidine-4-carbonyl]amino]acetic acid |
| SMILES | CN(CC(=O)O)C(=O)c1ccnc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H8F3N3O3/c1-15(4-6(16)17)7(18)5-2-3-13-8(14-5)9(10,11)12/h2-3H,4H2,1H3,(H,16,17) |
| InChIKey | GPDPFWMUGBNADB-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |