C16H16BrN3O4 — CID 110838742
N-[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]piperidine-4-carboxamide (PubChem CID 110838742) has the molecular formula C16H16BrN3O4 and a molecular weight of 394.23 g/mol. Its IUPAC name is N-[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110838742 |
| Molecular Formula | C16H16BrN3O4 |
| Molecular Weight | 394.23 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | N-[2-(5-bromo-1,3-dioxoisoindol-2-yl)acetyl]piperidine-4-carboxamide |
| SMILES | O=C(CN1C(=O)c2ccc(Br)cc2C1=O)NC(=O)C1CCNCC1 |
| InChI | InChI=1S/C16H16BrN3O4/c17-10-1-2-11-12(7-10)16(24)20(15(11)23)8-13(21)19-14(22)9-3-5-18-6-4-9/h1-2,7,9,18H,3-6,8H2,(H,19,21,22) |
| InChIKey | NBLGGKLVBMMBRV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|