C10H11NO — CID 11084179
2-methyl-1-pyridin-2-ylbuta-2,3-dien-1-ol (PubChem CID 11084179) has the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-methyl-1-pyridin-2-ylbuta-2,3-dien-1-ol.
| Compound Name | 2-methyl-1-pyridin-2-ylbuta-2,3-dien-1-ol |
|---|---|
| PubChem CID | 11084179 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-methyl-1-pyridin-2-ylbuta-2,3-dien-1-ol |
| SMILES | C=C=C(C)C(O)c1ccccn1 |
| InChI | InChI=1S/C10H11NO/c1-3-8(2)10(12)9-6-4-5-7-11-9/h4-7,10,12H,1H2,2H3 |
| InChIKey | YJPRVNZSOIXHKB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |