About (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone
(4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone (PubChem CID 110850018) has the molecular formula C12H16N4OS
and a molecular weight of 264.35 g/mol. Its IUPAC name is (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone.
Molecular Properties
| Compound Name | (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone |
| PubChem CID | 110850018 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone |
| SMILES | CCN1CCN(C(=O)c2csc3nccn23)CC1 |
| InChI | InChI=1S/C12H16N4OS/c1-2-14-5-7-15(8-6-14)11(17)10-9-18-12-13-3-4-16(10)12/h3-4,9H,2,5-8H2,1H3 |
| InChIKey | ZNSUHAYIGWXSRF-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone?
The IUPAC name of (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone (CID 110850018) is (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone.
What is the SMILES notation for (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone?
The canonical SMILES for (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone is CCN1CCN(C(=O)c2csc3nccn23)CC1.
What is the InChIKey of (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone?
The InChIKey is ZNSUHAYIGWXSRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4OS/c1-2-14-5-7-15(8-6-14)11(17)10-9-18-12-13-3-4-16(10)12/h3-4,9H,2,5-8H2,1H3.
What are the key properties of (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone?
(4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone has a molecular weight of 264.35 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylpiperazin-1-yl)-imidazo[2,1-b][1,3]thiazol-3-ylmethanone is sourced from PubChem (CID 110850018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).