C10H19NOS — CID 110855161
N,N-diethylthiane-3-carboxamide (PubChem CID 110855161) has the molecular formula C10H19NOS and a molecular weight of 201.33 g/mol. Its IUPAC name is N,N-diethylthiane-3-carboxamide.
| Compound Name | N,N-diethylthiane-3-carboxamide |
|---|---|
| PubChem CID | 110855161 |
| Molecular Formula | C10H19NOS |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | N,N-diethylthiane-3-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCCSC1 |
| InChI | InChI=1S/C10H19NOS/c1-3-11(4-2)10(12)9-6-5-7-13-8-9/h9H,3-8H2,1-2H3 |
| InChIKey | OKDANZABMINDRQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |